C8H7BrClF4N — CID 171248107
(1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethanamine;hydrochloride (PubChem CID 171248107) has the molecular formula C8H7BrClF4N and a molecular weight of 308.50 g/mol. Its IUPAC name is (1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethanamine;hydrochloride.
| Compound Name | (1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171248107 |
| Molecular Formula | C8H7BrClF4N |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | (1S)-1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(F)ccc(Br)c1F)C(F)F |
| InChI | InChI=1S/C8H6BrF4N.ClH/c9-3-1-2-4(10)5(6(3)11)7(14)8(12)13;/h1-2,7-8H,14H2;1H/t7-;/m0./s1 |
| InChIKey | SZPXLUMTFCKDQB-FJXQXJEOSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|