C8H7BrF4N2 — CID 106945433
[1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]hydrazine (PubChem CID 106945433) has the molecular formula C8H7BrF4N2 and a molecular weight of 287.05 g/mol. Its IUPAC name is [1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 106945433 |
| Molecular Formula | C8H7BrF4N2 |
| Molecular Weight | 287.05 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | [1-(3-bromo-2,6-difluorophenyl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(c1c(F)ccc(Br)c1F)C(F)F |
| InChI | InChI=1S/C8H7BrF4N2/c9-3-1-2-4(10)5(6(3)11)7(15-14)8(12)13/h1-2,7-8,15H,14H2 |
| InChIKey | SUYJJGPHDWZOMY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.05 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|