C13H17BrF2N2 — CID 106945625
[(3-bromo-2,6-difluorophenyl)-(1-methylcyclopentyl)methyl]hydrazine (PubChem CID 106945625) has the molecular formula C13H17BrF2N2 and a molecular weight of 319.19 g/mol. Its IUPAC name is [(3-bromo-2,6-difluorophenyl)-(1-methylcyclopentyl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,6-difluorophenyl)-(1-methylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106945625 |
| Molecular Formula | C13H17BrF2N2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [(3-bromo-2,6-difluorophenyl)-(1-methylcyclopentyl)methyl]hydrazine |
| SMILES | CC1(C(NN)c2c(F)ccc(Br)c2F)CCCC1 |
| InChI | InChI=1S/C13H17BrF2N2/c1-13(6-2-3-7-13)12(18-17)10-9(15)5-4-8(14)11(10)16/h4-5,12,18H,2-3,6-7,17H2,1H3 |
| InChIKey | LMIUIOMEPSKLLX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|