C15H22BrF2N3 — CID 106945372
1-[(3-bromo-2,6-difluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 106945372) has the molecular formula C15H22BrF2N3 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106945372 |
| Molecular Formula | C15H22BrF2N3 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CN(C)C1(C(NN)c2c(F)ccc(Br)c2F)CCCCC1 |
| InChI | InChI=1S/C15H22BrF2N3/c1-21(2)15(8-4-3-5-9-15)14(20-19)12-11(17)7-6-10(16)13(12)18/h6-7,14,20H,3-5,8-9,19H2,1-2H3 |
| InChIKey | OOOKDLLHLCJEKR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|