C15H23BrFN3 — CID 106649216
1-[(3-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 106649216) has the molecular formula C15H23BrFN3 and a molecular weight of 344.27 g/mol. Its IUPAC name is 1-[(3-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 1-[(3-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 106649216 |
| Molecular Formula | C15H23BrFN3 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[(3-bromo-2-fluorophenyl)-hydrazinylmethyl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CN(C)C1(C(NN)c2cccc(Br)c2F)CCCCC1 |
| InChI | InChI=1S/C15H23BrFN3/c1-20(2)15(9-4-3-5-10-15)14(19-18)11-7-6-8-12(16)13(11)17/h6-8,14,19H,3-5,9-10,18H2,1-2H3 |
| InChIKey | ZESPORGVWNBJDX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|