C14H18BrFO — CID 106831073
(3-bromo-2-fluorophenyl)-(1-methylcyclohexyl)methanol (PubChem CID 106831073) has the molecular formula C14H18BrFO and a molecular weight of 301.20 g/mol. Its IUPAC name is (3-bromo-2-fluorophenyl)-(1-methylcyclohexyl)methanol.
| Compound Name | (3-bromo-2-fluorophenyl)-(1-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106831073 |
| Molecular Formula | C14H18BrFO |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (3-bromo-2-fluorophenyl)-(1-methylcyclohexyl)methanol |
| SMILES | CC1(C(O)c2cccc(Br)c2F)CCCCC1 |
| InChI | InChI=1S/C14H18BrFO/c1-14(8-3-2-4-9-14)13(17)10-6-5-7-11(15)12(10)16/h5-7,13,17H,2-4,8-9H2,1H3 |
| InChIKey | RAINZVSLKBUTKQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |