C12H16FNO — CID 115834007
(3-fluoro-4-pyridinyl)-(1-methylcyclopentyl)methanol (PubChem CID 115834007) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-(1-methylcyclopentyl)methanol.
| Compound Name | (3-fluoro-4-pyridinyl)-(1-methylcyclopentyl)methanol |
|---|---|
| PubChem CID | 115834007 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-(1-methylcyclopentyl)methanol |
| SMILES | CC1(C(O)c2ccncc2F)CCCC1 |
| InChI | InChI=1S/C12H16FNO/c1-12(5-2-3-6-12)11(15)9-4-7-14-8-10(9)13/h4,7-8,11,15H,2-3,5-6H2,1H3 |
| InChIKey | QNQCJNCHIVRDSP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |