C9H12FNO2 — CID 103454633
1-(3-fluoro-4-pyridinyl)butane-1,2-diol (PubChem CID 103454633) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)butane-1,2-diol.
| Compound Name | 1-(3-fluoro-4-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 103454633 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)butane-1,2-diol |
| SMILES | CCC(O)C(O)c1ccncc1F |
| InChI | InChI=1S/C9H12FNO2/c1-2-8(12)9(13)6-3-4-11-5-7(6)10/h3-5,8-9,12-13H,2H2,1H3 |
| InChIKey | WDIOPFCNZDKOLB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |