4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid

C9H10FNO4 — CID 171877157

IUPAC4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid
SMILESO=C(O)CC(O)C(O)c1ccncc1F
InChIInChI=1S/C9H10FNO4/c10-6-4-11-2-1-5(6)9(15)7(12)3-8(13)14/h1-2,4,7,9,12,15H,3H2,(H,13,14)
InChIKeyUUEYVSIFMAQSBT-UHFFFAOYSA-N
MW215.18 g/mol
LogP0.09
Rot. Bonds4

About 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid

4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877157) has the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. Its IUPAC name is 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid
PubChem CID171877157
Molecular FormulaC9H10FNO4
Molecular Weight215.18 g/mol
Exact Mass215.06
IUPAC Name4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid
SMILESO=C(O)CC(O)C(O)c1ccncc1F
InChIInChI=1S/C9H10FNO4/c10-6-4-11-2-1-5(6)9(15)7(12)3-8(13)14/h1-2,4,7,9,12,15H,3H2,(H,13,14)
InChIKeyUUEYVSIFMAQSBT-UHFFFAOYSA-N
XLogP0.09
TPSA90.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.18
LogP ≤ 50.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid (CID 171877157) is 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid is O=C(O)CC(O)C(O)c1ccncc1F.
What is the InChIKey of 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid?
The InChIKey is UUEYVSIFMAQSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO4/c10-6-4-11-2-1-5(6)9(15)7(12)3-8(13)14/h1-2,4,7,9,12,15H,3H2,(H,13,14).
What are the key properties of 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid?
4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid has a molecular weight of 215.18 g/mol, XLogP of 0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171877157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).