C9H10FNO4 — CID 171877157
4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877157) has the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. Its IUPAC name is 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877157 |
| Molecular Formula | C9H10FNO4 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(3-fluoro-4-pyridinyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccncc1F |
| InChI | InChI=1S/C9H10FNO4/c10-6-4-11-2-1-5(6)9(15)7(12)3-8(13)14/h1-2,4,7,9,12,15H,3H2,(H,13,14) |
| InChIKey | UUEYVSIFMAQSBT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |