C8H10N2O3 — CID 55293779
3-amino-3-(3-hydroxy-4-pyridinyl)propanoic acid (PubChem CID 55293779) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 3-amino-3-(3-hydroxy-4-pyridinyl)propanoic acid.
| Compound Name | 3-amino-3-(3-hydroxy-4-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 55293779 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-amino-3-(3-hydroxy-4-pyridinyl)propanoic acid |
| SMILES | NC(CC(=O)O)c1ccncc1O |
| InChI | InChI=1S/C8H10N2O3/c9-6(3-8(12)13)5-1-2-10-4-7(5)11/h1-2,4,6,11H,3,9H2,(H,12,13) |
| InChIKey | BTHQIUSOVUVNCZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |