C9H11NO4 — CID 53417335
3-amino-3-(2,5-dihydroxyphenyl)propanoic acid (PubChem CID 53417335) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-amino-3-(2,5-dihydroxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(2,5-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 53417335 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-amino-3-(2,5-dihydroxyphenyl)propanoic acid |
| SMILES | NC(CC(=O)O)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H11NO4/c10-7(4-9(13)14)6-3-5(11)1-2-8(6)12/h1-3,7,11-12H,4,10H2,(H,13,14) |
| InChIKey | PFOZQXQJMPCGIB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|