C11H18N2O2 — CID 171201118
2-[(1R)-1,5-diaminopentyl]benzene-1,4-diol (PubChem CID 171201118) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[(1R)-1,5-diaminopentyl]benzene-1,4-diol.
| Compound Name | 2-[(1R)-1,5-diaminopentyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 171201118 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[(1R)-1,5-diaminopentyl]benzene-1,4-diol |
| SMILES | NCCCC[C@@H](N)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H18N2O2/c12-6-2-1-3-10(13)9-7-8(14)4-5-11(9)15/h4-5,7,10,14-15H,1-3,6,12-13H2/t10-/m1/s1 |
| InChIKey | BDIGKPCBMVXTQU-SNVBAGLBSA-N |
| XLogP | 1.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|