C11H18N2O2 — CID 171200731
4-[(1R)-1,4-diaminobutyl]-3-methoxyphenol (PubChem CID 171200731) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-[(1R)-1,4-diaminobutyl]-3-methoxyphenol.
| Compound Name | 4-[(1R)-1,4-diaminobutyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171200731 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-[(1R)-1,4-diaminobutyl]-3-methoxyphenol |
| SMILES | COc1cc(O)ccc1[C@H](N)CCCN |
| InChI | InChI=1S/C11H18N2O2/c1-15-11-7-8(14)4-5-9(11)10(13)3-2-6-12/h4-5,7,10,14H,2-3,6,12-13H2,1H3/t10-/m1/s1 |
| InChIKey | NYQAHOBKVSDNGJ-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |