C11H17NO3 — CID 171200778
4-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol (PubChem CID 171200778) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol.
| Compound Name | 4-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171200778 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-[(1R)-1-amino-4-hydroxybutyl]-3-methoxyphenol |
| SMILES | COc1cc(O)ccc1[C@H](N)CCCO |
| InChI | InChI=1S/C11H17NO3/c1-15-11-7-8(14)4-5-9(11)10(12)3-2-6-13/h4-5,7,10,13-14H,2-3,6,12H2,1H3/t10-/m1/s1 |
| InChIKey | HQEJGXVKBYDVOM-SNVBAGLBSA-N |
| XLogP | 1.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |