C12H20ClNO3 — CID 171200259
(4R)-4-amino-4-(2,5-dimethoxyphenyl)butan-1-ol;hydrochloride (PubChem CID 171200259) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is (4R)-4-amino-4-(2,5-dimethoxyphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(2,5-dimethoxyphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171200259 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (4R)-4-amino-4-(2,5-dimethoxyphenyl)butan-1-ol;hydrochloride |
| SMILES | COc1ccc(OC)c([C@H](N)CCCO)c1.Cl |
| InChI | InChI=1S/C12H19NO3.ClH/c1-15-9-5-6-12(16-2)10(8-9)11(13)4-3-7-14;/h5-6,8,11,14H,3-4,7,13H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | WXQKGXHTDHVCDK-RFVHGSKJSA-N |
| XLogP | 1.90 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |