C14H24N2O2 — CID 116934724
1-(2,5-dimethoxyphenyl)-4-methylpentane-1,4-diamine (PubChem CID 116934724) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-4-methylpentane-1,4-diamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 116934724 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-4-methylpentane-1,4-diamine |
| SMILES | COc1ccc(OC)c(C(N)CCC(C)(C)N)c1 |
| InChI | InChI=1S/C14H24N2O2/c1-14(2,16)8-7-12(15)11-9-10(17-3)5-6-13(11)18-4/h5-6,9,12H,7-8,15-16H2,1-4H3 |
| InChIKey | SOAAAKRCVXHPGY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |