C11H13BrF3NO — CID 105156340
1-(2-bromo-5-methoxyphenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 105156340) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 105156340 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | COc1ccc(Br)c(C(N)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13BrF3NO/c1-17-7-2-3-9(12)8(6-7)10(16)4-5-11(13,14)15/h2-3,6,10H,4-5,16H2,1H3 |
| InChIKey | HVAKTCYLOWFWMI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |