C11H14BrNO — CID 112693724
1-(2-bromo-5-methoxyphenyl)but-3-en-1-amine (PubChem CID 112693724) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)but-3-en-1-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 112693724 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)but-3-en-1-amine |
| SMILES | C=CCC(N)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C11H14BrNO/c1-3-4-11(13)9-7-8(14-2)5-6-10(9)12/h3,5-7,11H,1,4,13H2,2H3 |
| InChIKey | AEIVFPNZJGTCMB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|