C10H16BrClN2O — CID 171204828
(1R)-1-(2-bromo-5-methoxyphenyl)propane-1,3-diamine;hydrochloride (PubChem CID 171204828) has the molecular formula C10H16BrClN2O and a molecular weight of 295.61 g/mol. Its IUPAC name is (1R)-1-(2-bromo-5-methoxyphenyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-(2-bromo-5-methoxyphenyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171204828 |
| Molecular Formula | C10H16BrClN2O |
| Molecular Weight | 295.61 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (1R)-1-(2-bromo-5-methoxyphenyl)propane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc(Br)c([C@H](N)CCN)c1.Cl |
| InChI | InChI=1S/C10H15BrN2O.ClH/c1-14-7-2-3-9(11)8(6-7)10(13)4-5-12;/h2-3,6,10H,4-5,12-13H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | YYQRNOSGIPNCOE-HNCPQSOCSA-N |
| XLogP | 2.23 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |