C11H14F3NO2 — CID 171200659
2-[(1R)-1-amino-4,4,4-trifluorobutyl]-5-methoxyphenol (PubChem CID 171200659) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-5-methoxyphenol.
| Compound Name | 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 171200659 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-5-methoxyphenol |
| SMILES | COc1ccc([C@H](N)CCC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-17-7-2-3-8(10(16)6-7)9(15)4-5-11(12,13)14/h2-3,6,9,16H,4-5,15H2,1H3/t9-/m1/s1 |
| InChIKey | NMULQVXYKCPMMH-SECBINFHSA-N |
| XLogP | 2.74 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|