C12H17NO2 — CID 171220210
2-[(1S)-1-amino-3-methylbut-3-enyl]-5-methoxyphenol (PubChem CID 171220210) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-methylbut-3-enyl]-5-methoxyphenol.
| Compound Name | 2-[(1S)-1-amino-3-methylbut-3-enyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 171220210 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[(1S)-1-amino-3-methylbut-3-enyl]-5-methoxyphenol |
| SMILES | C=C(C)C[C@H](N)c1ccc(OC)cc1O |
| InChI | InChI=1S/C12H17NO2/c1-8(2)6-11(13)10-5-4-9(15-3)7-12(10)14/h4-5,7,11,14H,1,6,13H2,2-3H3/t11-/m0/s1 |
| InChIKey | HWDDCZHFVYCQSH-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|