C14H19ClN2O — CID 171199753
(1R)-1-(5-methoxy-1H-indol-3-yl)-3-methylbut-3-en-1-amine;hydrochloride (PubChem CID 171199753) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is (1R)-1-(5-methoxy-1H-indol-3-yl)-3-methylbut-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(5-methoxy-1H-indol-3-yl)-3-methylbut-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171199753 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1R)-1-(5-methoxy-1H-indol-3-yl)-3-methylbut-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1c[nH]c2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C14H18N2O.ClH/c1-9(2)6-13(15)12-8-16-14-5-4-10(17-3)7-11(12)14;/h4-5,7-8,13,16H,1,6,15H2,2-3H3;1H/t13-;/m1./s1 |
| InChIKey | WFCSTOYATGTYIS-BTQNPOSSSA-N |
| XLogP | 3.56 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|