C11H15ClN2O2 — CID 171199760
(2S)-2-amino-2-(5-methoxy-1H-indol-3-yl)ethanol;hydrochloride (PubChem CID 171199760) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is (2S)-2-amino-2-(5-methoxy-1H-indol-3-yl)ethanol;hydrochloride.
| Compound Name | (2S)-2-amino-2-(5-methoxy-1H-indol-3-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171199760 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (2S)-2-amino-2-(5-methoxy-1H-indol-3-yl)ethanol;hydrochloride |
| SMILES | COc1ccc2[nH]cc([C@H](N)CO)c2c1.Cl |
| InChI | InChI=1S/C11H14N2O2.ClH/c1-15-7-2-3-11-8(4-7)9(5-13-11)10(12)6-14;/h2-5,10,13-14H,6,12H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | NKJTXVJFWAJEBM-HNCPQSOCSA-N |
| XLogP | 1.59 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |