C12H16F3NO2 — CID 82982095
5-methoxy-2-[1-[methyl(2,2,2-trifluoroethyl)amino]ethyl]phenol (PubChem CID 82982095) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 5-methoxy-2-[1-[methyl(2,2,2-trifluoroethyl)amino]ethyl]phenol.
| Compound Name | 5-methoxy-2-[1-[methyl(2,2,2-trifluoroethyl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 82982095 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-methoxy-2-[1-[methyl(2,2,2-trifluoroethyl)amino]ethyl]phenol |
| SMILES | COc1ccc(C(C)N(C)CC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C12H16F3NO2/c1-8(16(2)7-12(13,14)15)10-5-4-9(18-3)6-11(10)17/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | DLFPJJUIPWRGAP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|