C14H20F3NO2 — CID 82982580
5-methoxy-2-[1-[propyl(2,2,2-trifluoroethyl)amino]ethyl]phenol (PubChem CID 82982580) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-methoxy-2-[1-[propyl(2,2,2-trifluoroethyl)amino]ethyl]phenol.
| Compound Name | 5-methoxy-2-[1-[propyl(2,2,2-trifluoroethyl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 82982580 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-methoxy-2-[1-[propyl(2,2,2-trifluoroethyl)amino]ethyl]phenol |
| SMILES | CCCN(CC(F)(F)F)C(C)c1ccc(OC)cc1O |
| InChI | InChI=1S/C14H20F3NO2/c1-4-7-18(9-14(15,16)17)10(2)12-6-5-11(20-3)8-13(12)19/h5-6,8,10,19H,4,7,9H2,1-3H3 |
| InChIKey | BPOWMHUIWCMFPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|