C19H22O5 — CID 151498938
2,4-bis(2-hydroxy-4-methoxyphenyl)pentan-3-one (PubChem CID 151498938) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2,4-bis(2-hydroxy-4-methoxyphenyl)pentan-3-one.
| Compound Name | 2,4-bis(2-hydroxy-4-methoxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 151498938 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2,4-bis(2-hydroxy-4-methoxyphenyl)pentan-3-one |
| SMILES | COc1ccc(C(C)C(=O)C(C)c2ccc(OC)cc2O)c(O)c1 |
| InChI | InChI=1S/C19H22O5/c1-11(15-7-5-13(23-3)9-17(15)20)19(22)12(2)16-8-6-14(24-4)10-18(16)21/h5-12,20-21H,1-4H3 |
| InChIKey | PPZRTUDOTWGEPZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |