C33H34O3S2 — CID 174863541
2,4-bis(2-benzylsulfanyl-4-methoxyphenyl)pentan-3-one (PubChem CID 174863541) has the molecular formula C33H34O3S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is 2,4-bis(2-benzylsulfanyl-4-methoxyphenyl)pentan-3-one.
| Compound Name | 2,4-bis(2-benzylsulfanyl-4-methoxyphenyl)pentan-3-one |
|---|---|
| PubChem CID | 174863541 |
| Molecular Formula | C33H34O3S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2,4-bis(2-benzylsulfanyl-4-methoxyphenyl)pentan-3-one |
| SMILES | COc1ccc(C(C)C(=O)C(C)c2ccc(OC)cc2SCc2ccccc2)c(SCc2ccccc2)c1 |
| InChI | InChI=1S/C33H34O3S2/c1-23(29-17-15-27(35-3)19-31(29)37-21-25-11-7-5-8-12-25)33(34)24(2)30-18-16-28(36-4)20-32(30)38-22-26-13-9-6-10-14-26/h5-20,23-24H,21-22H2,1-4H3 |
| InChIKey | HDFPHQYYVOMUFI-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |