C11H11F6NO2 — CID 171210135
2-[(1R)-1-amino-4,4,4-trifluorobutyl]-4-(trifluoromethoxy)phenol (PubChem CID 171210135) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171210135 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[(1R)-1-amino-4,4,4-trifluorobutyl]-4-(trifluoromethoxy)phenol |
| SMILES | N[C@H](CCC(F)(F)F)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C11H11F6NO2/c12-10(13,14)4-3-8(18)7-5-6(1-2-9(7)19)20-11(15,16)17/h1-2,5,8,19H,3-4,18H2/t8-/m1/s1 |
| InChIKey | JPWCRSVPPNACQF-MRVPVSSYSA-N |
| XLogP | 3.63 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|