C11H15ClF3NO3 — CID 171210167
2-[(1R)-1-amino-4-hydroxybutyl]-4-(trifluoromethoxy)phenol;hydrochloride (PubChem CID 171210167) has the molecular formula C11H15ClF3NO3 and a molecular weight of 301.69 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4-hydroxybutyl]-4-(trifluoromethoxy)phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-4-hydroxybutyl]-4-(trifluoromethoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 171210167 |
| Molecular Formula | C11H15ClF3NO3 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[(1R)-1-amino-4-hydroxybutyl]-4-(trifluoromethoxy)phenol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C11H14F3NO3.ClH/c12-11(13,14)18-7-3-4-10(17)8(6-7)9(15)2-1-5-16;/h3-4,6,9,16-17H,1-2,5,15H2;1H/t9-;/m1./s1 |
| InChIKey | OEWAAJJAVIEWBF-SBSPUUFOSA-N |
| XLogP | 2.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|