C11H13ClF3NO2 — CID 171210124
2-[(1R)-1-aminobut-3-enyl]-4-(trifluoromethoxy)phenol;hydrochloride (PubChem CID 171210124) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 2-[(1R)-1-aminobut-3-enyl]-4-(trifluoromethoxy)phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-aminobut-3-enyl]-4-(trifluoromethoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 171210124 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[(1R)-1-aminobut-3-enyl]-4-(trifluoromethoxy)phenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cc(OC(F)(F)F)ccc1O.Cl |
| InChI | InChI=1S/C11H12F3NO2.ClH/c1-2-3-9(15)8-6-7(4-5-10(8)16)17-11(12,13)14;/h2,4-6,9,16H,1,3,15H2;1H/t9-;/m1./s1 |
| InChIKey | YZTAUPIVBQQQSA-SBSPUUFOSA-N |
| XLogP | 3.29 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|