C10H12F3NO3 — CID 171210164
2-[(1R)-1-amino-3-hydroxypropyl]-4-(trifluoromethoxy)phenol (PubChem CID 171210164) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxypropyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R)-1-amino-3-hydroxypropyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171210164 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxypropyl]-4-(trifluoromethoxy)phenol |
| SMILES | N[C@H](CCO)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C10H12F3NO3/c11-10(12,13)17-6-1-2-9(16)7(5-6)8(14)3-4-15/h1-2,5,8,15-16H,3-4,14H2/t8-/m1/s1 |
| InChIKey | QSQZSPCVDCZVMX-MRVPVSSYSA-N |
| XLogP | 1.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|