C10H9F6NO3 — CID 171264169
2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4-(trifluoromethoxy)phenol (PubChem CID 171264169) has the molecular formula C10H9F6NO3 and a molecular weight of 305.17 g/mol. Its IUPAC name is 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171264169 |
| Molecular Formula | C10H9F6NO3 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[(1R,2R)-1-amino-3,3,3-trifluoro-2-hydroxypropyl]-4-(trifluoromethoxy)phenol |
| SMILES | N[C@H](c1cc(OC(F)(F)F)ccc1O)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO3/c11-9(12,13)8(19)7(17)5-3-4(1-2-6(5)18)20-10(14,15)16/h1-3,7-8,18-19H,17H2/t7-,8-/m1/s1 |
| InChIKey | OFLQSJSTMQFUPP-HTQZYQBOSA-N |
| XLogP | 2.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|