C12H14F3NO3 — CID 171264157
2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol (PubChem CID 171264157) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171264157 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclopropyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol |
| SMILES | N[C@H](c1cc(OC(F)(F)F)ccc1O)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C12H14F3NO3/c13-12(14,15)19-7-3-4-9(17)8(5-7)10(16)11(18)6-1-2-6/h3-6,10-11,17-18H,1-2,16H2/t10-,11+/m1/s1 |
| InChIKey | ZFBMCERJWGPFRW-MNOVXSKESA-N |
| XLogP | 2.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|