C12H16F3NO3 — CID 171264165
2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-4-(trifluoromethoxy)phenol (PubChem CID 171264165) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171264165 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-4-(trifluoromethoxy)phenol |
| SMILES | CC(C)[C@H](O)[C@H](N)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H16F3NO3/c1-6(2)11(18)10(16)8-5-7(3-4-9(8)17)19-12(13,14)15/h3-6,10-11,17-18H,16H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | WHPUFYMPHHGRLS-MNOVXSKESA-N |
| XLogP | 2.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|