C13H18F3NO2 — CID 171210157
2-[(1R)-1-amino-4-methylpentyl]-4-(trifluoromethoxy)phenol (PubChem CID 171210157) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[(1R)-1-amino-4-methylpentyl]-4-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1R)-1-amino-4-methylpentyl]-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171210157 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[(1R)-1-amino-4-methylpentyl]-4-(trifluoromethoxy)phenol |
| SMILES | CC(C)CC[C@@H](N)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C13H18F3NO2/c1-8(2)3-5-11(17)10-7-9(4-6-12(10)18)19-13(14,15)16/h4,6-8,11,18H,3,5,17H2,1-2H3/t11-/m1/s1 |
| InChIKey | UTXYNGKWXHYMJQ-LLVKDONJSA-N |
| XLogP | 3.73 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|