C12H14ClF4NO4 — CID 171243090
ethyl (3R)-3-amino-2-fluoro-3-[2-hydroxy-5-(trifluoromethoxy)phenyl]propanoate;hydrochloride (PubChem CID 171243090) has the molecular formula C12H14ClF4NO4 and a molecular weight of 347.69 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-[2-hydroxy-5-(trifluoromethoxy)phenyl]propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-[2-hydroxy-5-(trifluoromethoxy)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171243090 |
| Molecular Formula | C12H14ClF4NO4 |
| Molecular Weight | 347.69 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-[2-hydroxy-5-(trifluoromethoxy)phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(OC(F)(F)F)ccc1O.Cl |
| InChI | InChI=1S/C12H13F4NO4.ClH/c1-2-20-11(19)9(13)10(17)7-5-6(3-4-8(7)18)21-12(14,15)16;/h3-5,9-10,18H,2,17H2,1H3;1H/t9?,10-;/m1./s1 |
| InChIKey | JPNZUILZIZHMNS-FJYJDOHQSA-N |
| XLogP | 2.61 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.69 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|