C12H17ClFNO4 — CID 171240573
ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-5-methoxyphenyl)propanoate;hydrochloride (PubChem CID 171240573) has the molecular formula C12H17ClFNO4 and a molecular weight of 293.72 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-5-methoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-5-methoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171240573 |
| Molecular Formula | C12H17ClFNO4 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(2-hydroxy-5-methoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1cc(OC)ccc1O.Cl |
| InChI | InChI=1S/C12H16FNO4.ClH/c1-3-18-12(16)10(13)11(14)8-6-7(17-2)4-5-9(8)15;/h4-6,10-11,15H,3,14H2,1-2H3;1H/t10?,11-;/m1./s1 |
| InChIKey | JDFPNSXZVRJWBP-PSDUUTOMSA-N |
| XLogP | 1.72 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|