C13H18FNO3 — CID 171250977
ethyl (3S)-3-amino-2-fluoro-3-(4-methoxy-2-methylphenyl)propanoate (PubChem CID 171250977) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(4-methoxy-2-methylphenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methoxy-2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 171250977 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methoxy-2-methylphenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(OC)cc1C |
| InChI | InChI=1S/C13H18FNO3/c1-4-18-13(16)11(14)12(15)10-6-5-9(17-3)7-8(10)2/h5-7,11-12H,4,15H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | XPRNRBJCPCIMAC-KIYNQFGBSA-N |
| XLogP | 1.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |