C13H15F4NO3 — CID 171249131
ethyl (3S)-3-amino-2-fluoro-3-[4-methoxy-2-(trifluoromethyl)phenyl]propanoate (PubChem CID 171249131) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-[4-methoxy-2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-[4-methoxy-2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171249131 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-[4-methoxy-2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F4NO3/c1-3-21-12(19)10(14)11(18)8-5-4-7(20-2)6-9(8)13(15,16)17/h4-6,10-11H,3,18H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | NOJCIDHWVSNPFS-DTIOYNMSSA-N |
| XLogP | 2.62 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |