C13H18FNO4 — CID 171246365
ethyl (3S)-3-amino-3-(2,5-dimethoxyphenyl)-2-fluoropropanoate (PubChem CID 171246365) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2,5-dimethoxyphenyl)-2-fluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2,5-dimethoxyphenyl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171246365 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2,5-dimethoxyphenyl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H18FNO4/c1-4-19-13(16)11(14)12(15)9-7-8(17-2)5-6-10(9)18-3/h5-7,11-12H,4,15H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | PLJSNHIJMIMHFG-KIYNQFGBSA-N |
| XLogP | 1.60 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |