C12H14ClF4NO3 — CID 171243069
ethyl (3R)-3-amino-2-fluoro-3-[2-(trifluoromethoxy)phenyl]propanoate;hydrochloride (PubChem CID 171243069) has the molecular formula C12H14ClF4NO3 and a molecular weight of 331.69 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-[2-(trifluoromethoxy)phenyl]propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-[2-(trifluoromethoxy)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 171243069 |
| Molecular Formula | C12H14ClF4NO3 |
| Molecular Weight | 331.69 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-[2-(trifluoromethoxy)phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@H](N)c1ccccc1OC(F)(F)F.Cl |
| InChI | InChI=1S/C12H13F4NO3.ClH/c1-2-19-11(18)9(13)10(17)7-5-3-4-6-8(7)20-12(14,15)16;/h3-6,9-10H,2,17H2,1H3;1H/t9?,10-;/m1./s1 |
| InChIKey | BJBASTCREUUREO-FJYJDOHQSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |