C15H21ClF3NO3 — CID 171269839
2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol;hydrochloride (PubChem CID 171269839) has the molecular formula C15H21ClF3NO3 and a molecular weight of 355.78 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol;hydrochloride.
| Compound Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol;hydrochloride |
|---|---|
| PubChem CID | 171269839 |
| Molecular Formula | C15H21ClF3NO3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-(trifluoromethoxy)phenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(OC(F)(F)F)ccc1O)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C15H20F3NO3.ClH/c16-15(17,18)22-10-6-7-12(20)11(8-10)13(19)14(21)9-4-2-1-3-5-9;/h6-9,13-14,20-21H,1-5,19H2;1H/t13-,14+;/m0./s1 |
| InChIKey | OQGPAXWNVGVLKP-LMRHVHIWSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|