C11H16ClNO — CID 171202308
2-[(1R)-1-aminobut-3-enyl]-4-methylphenol;hydrochloride (PubChem CID 171202308) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-[(1R)-1-aminobut-3-enyl]-4-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-aminobut-3-enyl]-4-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171202308 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(1R)-1-aminobut-3-enyl]-4-methylphenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cc(C)ccc1O.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-3-4-10(12)9-7-8(2)5-6-11(9)13;/h3,5-7,10,13H,1,4,12H2,2H3;1H/t10-;/m1./s1 |
| InChIKey | WLVNYBUCEOMINW-HNCPQSOCSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|