C12H21ClN2O — CID 171202303
2-[(1R)-1,5-diaminopentyl]-4-methylphenol;hydrochloride (PubChem CID 171202303) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 2-[(1R)-1,5-diaminopentyl]-4-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1,5-diaminopentyl]-4-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171202303 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[(1R)-1,5-diaminopentyl]-4-methylphenol;hydrochloride |
| SMILES | Cc1ccc(O)c([C@H](N)CCCCN)c1.Cl |
| InChI | InChI=1S/C12H20N2O.ClH/c1-9-5-6-12(15)10(8-9)11(14)4-2-3-7-13;/h5-6,8,11,15H,2-4,7,13-14H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | ZZZVMHFZBAMVDG-RFVHGSKJSA-N |
| XLogP | 2.25 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|