C11H18ClN3O3 — CID 171217251
2-[(1S)-1,5-diaminopentyl]-4-nitrophenol;hydrochloride (PubChem CID 171217251) has the molecular formula C11H18ClN3O3 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-[(1S)-1,5-diaminopentyl]-4-nitrophenol;hydrochloride.
| Compound Name | 2-[(1S)-1,5-diaminopentyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171217251 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[(1S)-1,5-diaminopentyl]-4-nitrophenol;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C11H17N3O3.ClH/c12-6-2-1-3-10(13)9-7-8(14(16)17)4-5-11(9)15;/h4-5,7,10,15H,1-3,6,12-13H2;1H/t10-;/m0./s1 |
| InChIKey | WPWHFQSYRHKKGB-PPHPATTJSA-N |
| XLogP | 1.85 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|