C11H16BrN3O3 — CID 171232890
2-bromo-6-[(1S)-1,5-diaminopentyl]-4-nitrophenol (PubChem CID 171232890) has the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-bromo-6-[(1S)-1,5-diaminopentyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[(1S)-1,5-diaminopentyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171232890 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-bromo-6-[(1S)-1,5-diaminopentyl]-4-nitrophenol |
| SMILES | NCCCC[C@H](N)c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C11H16BrN3O3/c12-9-6-7(15(17)18)5-8(11(9)16)10(14)3-1-2-4-13/h5-6,10,16H,1-4,13-14H2/t10-/m0/s1 |
| InChIKey | WGYCFVYMAVVBRP-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|