C11H16BrClN2O4 — CID 171264978
2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-6-bromo-4-nitrophenol;hydrochloride (PubChem CID 171264978) has the molecular formula C11H16BrClN2O4 and a molecular weight of 355.62 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-6-bromo-4-nitrophenol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-6-bromo-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171264978 |
| Molecular Formula | C11H16BrClN2O4 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-methylbutyl]-6-bromo-4-nitrophenol;hydrochloride |
| SMILES | CC(C)[C@H](O)[C@H](N)c1cc([N+](=O)[O-])cc(Br)c1O.Cl |
| InChI | InChI=1S/C11H15BrN2O4.ClH/c1-5(2)10(15)9(13)7-3-6(14(17)18)4-8(12)11(7)16;/h3-5,9-10,15-16H,13H2,1-2H3;1H/t9-,10+;/m1./s1 |
| InChIKey | BPEFDKIAXWRHQV-UXQCFNEQSA-N |
| XLogP | 2.50 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|