C9H9BrClF3N2O3 — CID 171213288
2-[(1R)-1-amino-3,3,3-trifluoropropyl]-6-bromo-4-nitrophenol;hydrochloride (PubChem CID 171213288) has the molecular formula C9H9BrClF3N2O3 and a molecular weight of 365.53 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3,3,3-trifluoropropyl]-6-bromo-4-nitrophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3,3,3-trifluoropropyl]-6-bromo-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171213288 |
| Molecular Formula | C9H9BrClF3N2O3 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 2-[(1R)-1-amino-3,3,3-trifluoropropyl]-6-bromo-4-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@H](CC(F)(F)F)c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C9H8BrF3N2O3.ClH/c10-6-2-4(15(17)18)1-5(8(6)16)7(14)3-9(11,12)13;/h1-2,7,16H,3,14H2;1H/t7-;/m1./s1 |
| InChIKey | DIOWKDIFWMLACA-OGFXRTJISA-N |
| XLogP | 3.44 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|