C9H9F3N2O3 — CID 171217267
2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-nitrophenol (PubChem CID 171217267) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-nitrophenol.
| Compound Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171217267 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[(1S)-1-amino-3,3,3-trifluoropropyl]-4-nitrophenol |
| SMILES | N[C@@H](CC(F)(F)F)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C9H9F3N2O3/c10-9(11,12)4-7(13)6-3-5(14(16)17)1-2-8(6)15/h1-3,7,15H,4,13H2/t7-/m0/s1 |
| InChIKey | BRRIFZWUQTZJSZ-ZETCQYMHSA-N |
| XLogP | 2.25 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|