C9H10F3NO2 — CID 131515495
2-[(1R)-1-amino-3,3,3-trifluoropropyl]benzene-1,4-diol (PubChem CID 131515495) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3,3,3-trifluoropropyl]benzene-1,4-diol.
| Compound Name | 2-[(1R)-1-amino-3,3,3-trifluoropropyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 131515495 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[(1R)-1-amino-3,3,3-trifluoropropyl]benzene-1,4-diol |
| SMILES | N[C@H](CC(F)(F)F)c1cc(O)ccc1O |
| InChI | InChI=1S/C9H10F3NO2/c10-9(11,12)4-7(13)6-3-5(14)1-2-8(6)15/h1-3,7,14-15H,4,13H2/t7-/m1/s1 |
| InChIKey | ZWZYQCXZTYMWHC-SSDOTTSWSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|